Difference between revisions of "CPD-13695"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HEME_C HEME_C] == * common name: ** heme c * Synonym(s): == Reaction(s) known to consume the c...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] == |
+ | * smiles: | ||
+ | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 6-oxocampestanol |
+ | * molecular weight: | ||
+ | ** 416.686 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** oxocampestanol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-715]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061347 16061347] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20747 20747] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15789 C15789] | ||
+ | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: inchi key=InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N}} | ||
+ | {{#set: common name=6-oxocampestanol}} | ||
+ | {{#set: molecular weight=416.686 }} | ||
+ | {{#set: common name=oxocampestanol}} | ||
+ | {{#set: consumed by=RXN-715}} |
Revision as of 18:09, 10 January 2018
Contents
Metabolite CPD-713
- smiles:
- CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N
- common name:
- 6-oxocampestanol
- molecular weight:
- 416.686
- Synonym(s):
- oxocampestanol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.