Difference between revisions of "CPD-18761"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-phospho-ligated-tRNA 2-phospho-ligated-tRNA] == * common name: ** a 2'-phospho-[ligated tRNA]...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-phospho-ligated-tRNA 2-phospho-ligated-tRNA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13377 CPD-13377] ==
 +
* smiles:
 +
** C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
 +
* inchi key:
 +
** InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N
 
* common name:
 
* common name:
** a 2'-phospho-[ligated tRNA]
+
** XLXG xyloglucan oligosaccharide
 +
* molecular weight:
 +
** 1225.073   
 
* Synonym(s):
 
* Synonym(s):
** a tRNA with a 2'-phosphate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.160-RXN]]
+
* [[RXN-12399]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a 2'-phospho-[ligated tRNA]}}
+
* PUBCHEM:
{{#set: common name=a tRNA with a 2'-phosphate}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940192 52940192]
{{#set: consumed by=2.7.1.160-RXN}}
+
{{#set: smiles=C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)}}
 +
{{#set: inchi key=InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N}}
 +
{{#set: common name=XLXG xyloglucan oligosaccharide}}
 +
{{#set: molecular weight=1225.073    }}
 +
{{#set: consumed by=RXN-12399}}

Revision as of 17:09, 10 January 2018

Metabolite CPD-13377

  • smiles:
    • C8(C(C(C(C(OCC7(OC(OC3(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))3)OC5(C(O)C(O)C(OC(COC4(C(C(C(CO4)O)O)O))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
  • inchi key:
    • InChIKey=KBCZEXDVBXUVGR-IKGYADNMSA-N
  • common name:
    • XLXG xyloglucan oligosaccharide
  • molecular weight:
    • 1225.073
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links