Difference between revisions of "CPD-19492"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] == * smiles: ** CSCCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=QDZNKMGEHAHO...")
 
(Created page with "Category:Gene == Gene Tiso_gene_16772 == * left end position: ** 376 * transcription direction: ** POSITIVE * right end position: ** 1379 * centisome position: ** 9.106321...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] ==
+
== Gene Tiso_gene_16772 ==
−
* smiles:
+
* left end position:
−
** CSCCCCCCC(=O)C([O-])=O
+
** 376
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 8-(methylthio)-2-oxooctanoate
+
** 1379
−
* molecular weight:
+
* centisome position:
−
** 203.276    
+
** 9.106321    
 
* Synonym(s):
 
* Synonym(s):
−
** 8-(methylthio)-2-oxooctanoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[2.4.1.83-RXN]]
−
* [[RXN-18205]]
+
** in-silico_annotation
−
* [[RXNQT-4171]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[esiliculosus]]
 +
* [[RXN-16602]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7661]]
 +
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=376}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237313 44237313]
+
{{#set: transcription direction=POSITIVE}}
−
* KNAPSACK : C00007643
+
{{#set: right end position=1379}}
−
{{#set: smiles=CSCCCCCCC(=O)C([O-])=O}}
+
{{#set: centisome position=9.106321   }}
−
{{#set: inchi key=InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M}}
+
{{#set: reaction associated=2.4.1.83-RXN|RXN-16602}}
−
{{#set: common name=8-(methylthio)-2-oxooctanoate}}
+
{{#set: pathway associated=PWY-7661|MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS}}
−
{{#set: molecular weight=203.276   }}
+
−
{{#set: common name=8-(methylthio)-2-oxooctanoic acid}}
+
−
{{#set: produced by=RXN-18205|RXNQT-4171}}
+

Revision as of 17:10, 10 January 2018

Gene Tiso_gene_16772

  • left end position:
    • 376
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1379
  • centisome position:
    • 9.106321
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-19492&oldid=16485"