Difference between revisions of "RXN-1126"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-leucyl-L-lysyl-Protein L-leucyl-L-lysyl-Protein] == * common name: ** a [protein] N-terminal...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] == * smiles: ** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] == |
| + | * smiles: | ||
| + | ** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O) | ||
| + | * inchi key: | ||
| + | ** InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** XXXG xyloglucan oligosaccharide |
| + | * molecular weight: | ||
| + | ** 1062.931 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12400]] |
| + | * [[RXN-12399]] | ||
| + | * [[RXN-12398]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940180 52940180] |
| − | {{#set: produced by= | + | {{#set: smiles=C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)}} |
| + | {{#set: inchi key=InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N}} | ||
| + | {{#set: common name=XXXG xyloglucan oligosaccharide}} | ||
| + | {{#set: molecular weight=1062.931 }} | ||
| + | {{#set: produced by=RXN-12400|RXN-12399|RXN-12398}} | ||
Revision as of 17:11, 10 January 2018
Contents
Metabolite CPD-13375
- smiles:
- C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)
- inchi key:
- InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N
- common name:
- XXXG xyloglucan oligosaccharide
- molecular weight:
- 1062.931
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
