Difference between revisions of "Tiso gene 19475"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CITRULLINE L-CITRULLINE] == * smiles: ** C(NC(N)=O)CCC([N+])C(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Tiso_gene_17723 == * left end position: ** 1904 * transcription direction: ** POSITIVE * right end position: ** 3462 * centisome position: ** 54.4622...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17723 == |
− | * | + | * left end position: |
− | ** | + | ** 1904 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3462 |
− | * | + | * centisome position: |
− | ** | + | ** 54.462242 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN-11638]] |
− | + | ** in-silico_annotation | |
− | + | ***automated-name-match | |
− | * | + | ** experimental_annotation |
− | * | + | ***automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1904}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3462}} | |
− | + | {{#set: centisome position=54.462242 }} | |
− | + | {{#set: reaction associated=RXN-11638}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 18:12, 10 January 2018
Gene Tiso_gene_17723
- left end position:
- 1904
- transcription direction:
- POSITIVE
- right end position:
- 3462
- centisome position:
- 54.462242
- Synonym(s):
Reactions associated
- RXN-11638
- in-silico_annotation
- automated-name-match
- experimental_annotation
- automated-name-match
- in-silico_annotation