Difference between revisions of "Tiso gene 8612"

Revision as of 18:13, 10 January 2018

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Propionyl-CoA-CO2-ligases Propionyl-CoA-CO2-ligases] ==
-* smiles:
-** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))
-* inchi key:
-** InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L
 * common name:
-** tetraiodothyroacetate ether glucuronide
+** [propionyl-CoA:carbon-dioxide ligase (ADP-forming)]
-* molecular weight:
-** 921.943
 * Synonym(s):
-** tetraiodothyroacetic acid ether glucuronide
 == Reaction(s) known to consume the compound ==
 == Reaction(s) known to produce the compound ==
-* [[RXN-10616]]
+* [[6.3.4.10-RXN]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-* PUBCHEM:
+{{#set: common name=[propionyl-CoA:carbon-dioxide ligase (ADP-forming)]}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659237 90659237]
+{{#set: produced by=6.3.4.10-RXN}}
-{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))}}
-{{#set: inchi key=InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L}}
-{{#set: common name=tetraiodothyroacetate ether glucuronide}}
-{{#set: molecular weight=921.943    }}
-{{#set: common name=tetraiodothyroacetic acid ether glucuronide}}
-{{#set: produced by=RXN-10616}}