Difference between revisions of "DIHYDROXY-BUTANONE-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] == * smiles: ** CC(=O)C(O)COP(=O)([O-])[O-] * inchi...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14048 RXN-14048] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14048 RXN-14048] ==
−
* smiles:
+
* direction:
−
** CC(=O)C(O)COP(=O)([O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L
+
−
* common name:
+
−
** 1-deoxy-L-glycero-tetrulose 4-phosphate
+
−
* molecular weight:
+
−
** 182.069   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3,4-dihydroxy-2-butanone-4-phosphate
 
−
** tetrolose phosphate
 
−
** 3,4-dihydroxy-2-butanone-4-P
 
−
** L-3,4-dihydroxybutan-2-one-4-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[DIOHBUTANONEPSYN-RXN]]
+
** 1 [[L-CYSTATHIONINE]][c] '''=>''' 1 [[CYS]][c] '''+''' 1 [[CPD-15056]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-cystathionine[c] '''=>''' 1 L-cysteine[c] '''+''' 1 (2Z)-2-aminobut-2-enoate[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_3732]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[HOMOCYSDEGR-PWY]], L-cysteine biosynthesis III (from L-homocysteine): [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSDEGR-PWY HOMOCYSDEGR-PWY]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
* [[PWY-801]], L-homocysteine and L-cysteine interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-801 PWY-801]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658385 90658385]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24913 24913]
−
* CHEMSPIDER:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.chemspider.com/Chemical-Structure.10739351.html 10739351]
+
{{#set: gene associated=Tiso_gene_3732}}
−
* CHEBI:
+
{{#set: in pathway=HOMOCYSDEGR-PWY|PWY-801}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50606 50606]
+
{{#set: reconstruction category=orthology}}
−
* BIGG : db4p
+
{{#set: reconstruction tool=pantograph}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=esiliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15556 C15556]
+
−
{{#set: smiles=CC(=O)C(O)COP(=O)([O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L}}
+
−
{{#set: common name=1-deoxy-L-glycero-tetrulose 4-phosphate}}
+
−
{{#set: molecular weight=182.069    }}
+
−
{{#set: common name=3,4-dihydroxy-2-butanone-4-phosphate|tetrolose phosphate|3,4-dihydroxy-2-butanone-4-P|L-3,4-dihydroxybutan-2-one-4-phosphate}}
+
−
{{#set: produced by=DIOHBUTANONEPSYN-RXN}}
+

Revision as of 17:13, 10 January 2018

Reaction RXN-14048

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 L-cystathionine[c] => 1 L-cysteine[c] + 1 (2Z)-2-aminobut-2-enoate[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • HOMOCYSDEGR-PWY, L-cysteine biosynthesis III (from L-homocysteine): HOMOCYSDEGR-PWY
    • 4 reactions found over 4 reactions in the full pathway
  • PWY-801, L-homocysteine and L-cysteine interconversion: PWY-801
    • 3 reactions found over 3 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DIHYDROXY-BUTANONE-P&oldid=16748"