Difference between revisions of "FACOAL18111Z"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12508 RXN-12508] == * direction: ** LEFT-TO-RIGHT * common name: ** 2-(α-hydroxyethyl)-TP...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11409 CPD-11409] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3)) |
+ | * inchi key: | ||
+ | ** InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** tetraiodothyroacetate ether glucuronide |
− | * | + | * molecular weight: |
− | + | ** 921.943 | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** tetraiodothyroacetic acid ether glucuronide | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10616]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659237 90659237] |
− | {{#set: | + | {{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))}} |
− | + | {{#set: inchi key=InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L}} | |
− | + | {{#set: common name=tetraiodothyroacetate ether glucuronide}} | |
− | {{#set: | + | {{#set: molecular weight=921.943 }} |
− | {{#set: common name= | + | {{#set: common name=tetraiodothyroacetic acid ether glucuronide}} |
− | {{#set: | + | {{#set: produced by=RXN-10616}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 17:13, 10 January 2018
Contents
Metabolite CPD-11409
- smiles:
- C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))
- inchi key:
- InChIKey=GYORPZQLVMNOGY-RUPWJETCSA-L
- common name:
- tetraiodothyroacetate ether glucuronide
- molecular weight:
- 921.943
- Synonym(s):
- tetraiodothyroacetic acid ether glucuronide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C(I)=C3))" cannot be used as a page name in this wiki.