Difference between revisions of "O-SUCCHOMOSERLYASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7630 CPD-7630] == * smiles: ** C3(=C(C2(OC1(=CC(=CC(=C1CC2O)O)O)))C=C(O)C(=C3)O) * inchi ke...") |
(Created page with "Category:Gene == Gene Tiso_gene_4467 == * left end position: ** 9357 * transcription direction: ** POSITIVE * right end position: ** 11138 * centisome position: ** 63.1717...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4467 == |
− | * | + | * left end position: |
− | ** | + | ** 9357 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 11138 |
− | * | + | * centisome position: |
− | ** | + | ** 63.17175 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | == | + | * [[PANTOTHENATE-KIN-RXN]] |
− | * [[ | + | ** in-silico_annotation |
− | + | ***ec-number | |
+ | == Pathways associated == | ||
+ | * [[PANTO-PWY]] | ||
+ | * [[PWY-3961]] | ||
+ | * [[COA-PWY-1]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=9357}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=11138}} | |
− | + | {{#set: centisome position=63.17175 }} | |
− | + | {{#set: reaction associated=PANTOTHENATE-KIN-RXN}} | |
− | + | {{#set: pathway associated=PANTO-PWY|PWY-3961|COA-PWY-1}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:13, 10 January 2018
Gene Tiso_gene_4467
- left end position:
- 9357
- transcription direction:
- POSITIVE
- right end position:
- 11138
- centisome position:
- 63.17175
- Synonym(s):
Reactions associated
- PANTOTHENATE-KIN-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation