Difference between revisions of "Tiso gene 14327"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-527 RXN-527] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.14...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] == * smiles: ** CCC(O)(C)C(=O)C(=O)[O-] * inchi key: ** InChIKey=YJVOWRAWF...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-527 RXN-527] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC(O)(C)C(=O)C(=O)[O-]
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.14.11.23 EC-1.14.11.23]
+
** InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M
 +
* common name:
 +
** (R)-3-hydroxy-3-methyl-2-oxopentanoate
 +
* molecular weight:
 +
** 145.135   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[R05068]]
−
** 1 [[CPD-474]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[SUC]][c] '''+''' 1 [[CPD-520]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 (+)-taxifolin[c] '''+''' 1 oxygen[c] '''+''' 1 2-oxoglutarate[c] '''=>''' 1 CO2[c] '''+''' 1 H2O[c] '''+''' 1 succinate[c] '''+''' 1 quercetin[c]
+
* [[RXN-14106]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3330]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-3101]], flavonol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3101 PWY-3101]
+
−
** '''4''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-5390]], rutin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5390 PWY-5390]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-6787]], flavonoid biosynthesis (in equisetum): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6787 PWY-6787]
+
−
** '''5''' reactions found over '''10''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
*** [[athaliana]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R02160 R02160]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20846131 20846131]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-1.14.11.23}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49257 49257]
−
{{#set: gene associated=Tiso_gene_3330}}
+
* LIGAND-CPD:
−
{{#set: in pathway=PWY-3101|PWY-5390|PWY-6787}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C14463 C14463]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=CCC(O)(C)C(=O)C(=O)[O-]}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M}}
−
{{#set: reconstruction source=esiliculosus|athaliana}}
+
{{#set: common name=(R)-3-hydroxy-3-methyl-2-oxopentanoate}}
 +
{{#set: molecular weight=145.135    }}
 +
{{#set: consumed by=R05068}}
 +
{{#set: consumed or produced by=RXN-14106}}

Revision as of 17:14, 10 January 2018

Metabolite CPD-15104

  • smiles:
    • CCC(O)(C)C(=O)C(=O)[O-]
  • inchi key:
    • InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M
  • common name:
    • (R)-3-hydroxy-3-methyl-2-oxopentanoate
  • molecular weight:
    • 145.135
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC(O)(C)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14327&oldid=16791"