Difference between revisions of "Tiso gene 19078"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10617 == * left end position: ** 2539 * transcription direction: ** POSITIVE * right end position: ** 5351 * centisome position: ** 30.1902...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] == * smiles: ** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-] *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L |
| − | * | + | * common name: |
| − | ** | + | ** 2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one |
| − | * | + | * molecular weight: |
| − | ** | + | ** 353.228 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-10058]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480553 45480553] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58890 58890] |
| − | {{#set: | + | {{#set: smiles=C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L}} |
| + | {{#set: common name=2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one}} | ||
| + | {{#set: molecular weight=353.228 }} | ||
| + | {{#set: common name=2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate}} | ||
| + | {{#set: consumed by=RXN-10058}} | ||
Revision as of 17:14, 10 January 2018
Contents
Metabolite CPD-10809
- smiles:
- C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]
- inchi key:
- InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L
- common name:
- 2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one
- molecular weight:
- 353.228
- Synonym(s):
- 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.
