Difference between revisions of "Tiso gene 17377"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] == * smiles: ** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O * inchi key: ** In...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17113 RXN-17113] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase * e...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17113 RXN-17113] ==
−
* smiles:
+
* direction:
−
** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** paraoxon
+
** acyl-coenzyme_a_oxidase
−
* molecular weight:
+
* ec number:
−
** 275.197   
+
** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6]
 
* Synonym(s):
 
* Synonym(s):
−
** O,O-diethyl-O-p-nitrophenylphosphoric acid
 
−
** diethyl-p-nitrophenyl phosphate
 
−
** phosphoric acid diethyl 4-nitrophenyl ester
 
−
** diethyl paraoxon
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8746]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-18491]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-18492]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 (6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA[c] '''+''' 1 oxygen[c] '''=>''' 1 (2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA[c] '''+''' 1 hydrogen peroxide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_18566]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7726]], (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7726 PWY-7726]
 +
** '''5''' reactions found over '''13''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
−
* CAS : 311-45-5
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=acyl-coenzyme_a_oxidase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9395 9395]
+
{{#set: ec number=EC-1.3.3.6}}
−
* HMDB : HMDB13035
+
{{#set: gene associated=Tiso_gene_18566}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7726}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06606 C06606]
+
{{#set: reconstruction category=annotation}}
−
* CHEMSPIDER:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.chemspider.com/Chemical-Structure.9026.html 9026]
+
{{#set: reconstruction source=in-silico_annotation}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27827 27827]
+
−
{{#set: smiles=CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O}}
+
−
{{#set: inchi key=InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N}}
+
−
{{#set: common name=paraoxon}}
+
−
{{#set: molecular weight=275.197    }}
+
−
{{#set: common name=O,O-diethyl-O-p-nitrophenylphosphoric acid|diethyl-p-nitrophenyl phosphate|phosphoric acid diethyl 4-nitrophenyl ester|diethyl paraoxon}}
+
−
{{#set: consumed by=RXN-8746}}
+

Revision as of 17:14, 10 January 2018

Reaction RXN-17113

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl-coenzyme_a_oxidase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA[c] + 1 oxygen[c] => 1 (2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA[c] + 1 hydrogen peroxide[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7726, (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase): PWY-7726
    • 5 reactions found over 13 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17377&oldid=16821"