Difference between revisions of "Tiso gene 8720"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=10-FORMYL-THF 10-FORMYL-THF] == * smiles: ** C2([CH](CN(C=O)C1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-468 RXN1G-468] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis,cis-delta7...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=10-FORMYL-THF 10-FORMYL-THF] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-468 RXN1G-468] ==
−
* smiles:
+
* direction:
−
** C2([CH](CN(C=O)C1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))NC3(C(=O)NC(N)=NC(N2)=3))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=AUFGTPPARQZWDO-YPMHNXCESA-L
+
 
* common name:
 
* common name:
−
** 10-formyl-tetrahydrofolate mono-L-glutamate
+
** trans-delta2-cis,cis-delta7,25-C44:3-[acyl-carrier protein] reductase
−
* molecular weight:
+
* ec number:
−
** 471.429   
+
** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4]
 
* Synonym(s):
 
* Synonym(s):
−
** N10-formyl-tetrahydrofolate mono-L-glutamate
 
−
** N10-formyl-THF mono-L-glutamate
 
−
** N10-formyl-H4F mono-L-glutamate
 
−
** 10-formyl-THF mono-L-glutamate
 
−
** 10-formyl-H4PteGlu1
 
−
** N10-formyl-H4PteGlu1
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[FTHFO]]
+
* With identifiers:
−
* [[MTHFCx]]
+
** 1 [[PROTON]][c] '''+''' 1 [[trans-D2-cis-cis-D7-25-C44-3-ACPs]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[cis-cis-D7-25-C44-2-ACPs]][c]
−
* [[R04560]]
+
* With common name(s):
−
== Reaction(s) known to produce the compound ==
+
** 1 H+[c] '''+''' 1 a trans-delta2-cis,cis-delta7,25-C44:3-[acp][c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 a cis,cis-delta7,25-C44:2-[acp][c]
−
* [[FTHFL]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
−
* [[FPGFTm]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[R01655]]
+
* [[Tiso_gene_10778]]
−
* [[FPAIF]]
+
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
−
* CAS : 2800-34-2
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC57454
+
{{#set: common name=trans-delta2-cis,cis-delta7,25-C44:3-[acyl-carrier protein] reductase}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.3.1.M4}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878370 46878370]
+
{{#set: gene associated=Tiso_gene_10778}}
−
* HMDB : HMDB00972
+
{{#set: in pathway=PWYG-321}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00234 C00234]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEBI:
+
{{#set: reconstruction source=esiliculosus}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57454 57454]
+
−
* BIGG : 10fthf
+
−
{{#set: smiles=C2([CH](CN(C=O)C1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))NC3(C(=O)NC(N)=NC(N2)=3))}}
+
−
{{#set: inchi key=InChIKey=AUFGTPPARQZWDO-YPMHNXCESA-L}}
+
−
{{#set: common name=10-formyl-tetrahydrofolate mono-L-glutamate}}
+
−
{{#set: molecular weight=471.429    }}
+
−
{{#set: common name=N10-formyl-tetrahydrofolate mono-L-glutamate|N10-formyl-THF mono-L-glutamate|N10-formyl-H4F mono-L-glutamate|10-formyl-THF mono-L-glutamate|10-formyl-H4PteGlu1|N10-formyl-H4PteGlu1}}
+
−
{{#set: consumed by=FTHFO|MTHFCx|R04560}}
+
−
{{#set: produced by=FTHFL}}
+
−
{{#set: consumed or produced by=FPGFTm|R01655|FPAIF}}
+

Revision as of 17:14, 10 January 2018

Reaction RXN1G-468

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans-delta2-cis,cis-delta7,25-C44:3-[acyl-carrier protein] reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"trans-delta2-cis,cis-delta7,25-C44:3-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8720&oldid=16824"