Difference between revisions of "Tiso gene 12020"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: *...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L |
* common name: | * common name: | ||
− | ** | + | ** α-D-mannose 1-phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** mannose-1-phosphate |
− | ** | + | ** D-mannose-1-phosphate |
− | + | ** mannose-1-P | |
− | ** | + | ** α-D-mannopyranose 1-phosphate |
− | ** | + | |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2.7.7.13-RXN]] | ||
+ | * [[GAMPG]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[MANNPGUANYLTRANGDP-RXN]] | ||
+ | * [[PHOSMANMUT-RXN]] | ||
== External links == | == External links == | ||
+ | * CAS : 27251-84-9 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245607 25245607] |
− | * | + | * HMDB : HMDB06330 |
− | ** [http://www. | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00636 C00636] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58409 58409] |
− | {{#set: smiles=C( | + | * BIGG : man1p |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L}} |
− | {{#set: molecular weight= | + | {{#set: common name=α-D-mannose 1-phosphate}} |
− | {{#set: common name= | + | {{#set: molecular weight=258.121 }} |
− | {{#set: produced by=RXN- | + | {{#set: common name=mannose-1-phosphate|D-mannose-1-phosphate|mannose-1-P|α-D-mannopyranose 1-phosphate}} |
+ | {{#set: consumed by=2.7.7.13-RXN|GAMPG}} | ||
+ | {{#set: consumed or produced by=MANNPGUANYLTRANGDP-RXN|PHOSMANMUT-RXN}} |
Revision as of 17:14, 10 January 2018
Contents
Metabolite MANNOSE-1P
- smiles:
- C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
- inchi key:
- InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L
- common name:
- α-D-mannose 1-phosphate
- molecular weight:
- 258.121
- Synonym(s):
- mannose-1-phosphate
- D-mannose-1-phosphate
- mannose-1-P
- α-D-mannopyranose 1-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.