Difference between revisions of "Tiso gene 12997"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALA-tRNAs ALA-tRNAs] == * common name: ** a tRNAala * Synonym(s): ** TRNA(ALA) == Reaction(s)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] == * smiles: ** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O * inchi key: ** In...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] == |
| + | * smiles: | ||
| + | ** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** paraoxon |
| + | * molecular weight: | ||
| + | ** 275.197 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** O,O-diethyl-O-p-nitrophenylphosphoric acid |
| + | ** diethyl-p-nitrophenyl phosphate | ||
| + | ** phosphoric acid diethyl 4-nitrophenyl ester | ||
| + | ** diethyl paraoxon | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8746]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 311-45-5 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9395 9395] |
| + | * HMDB : HMDB13035 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C06606 C06606] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.9026.html 9026] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27827 27827] | ||
| + | {{#set: smiles=CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O}} | ||
| + | {{#set: inchi key=InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=paraoxon}} | ||
| + | {{#set: molecular weight=275.197 }} | ||
| + | {{#set: common name=O,O-diethyl-O-p-nitrophenylphosphoric acid|diethyl-p-nitrophenyl phosphate|phosphoric acid diethyl 4-nitrophenyl ester|diethyl paraoxon}} | ||
| + | {{#set: consumed by=RXN-8746}} | ||
Revision as of 17:14, 10 January 2018
Contents
Metabolite PARAOXON
- smiles:
- CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O
- inchi key:
- InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N
- common name:
- paraoxon
- molecular weight:
- 275.197
- Synonym(s):
- O,O-diethyl-O-p-nitrophenylphosphoric acid
- diethyl-p-nitrophenyl phosphate
- phosphoric acid diethyl 4-nitrophenyl ester
- diethyl paraoxon
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O" cannot be used as a page name in this wiki.
