Difference between revisions of "RXN-2006"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5398 RXN0-5398] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/4.2...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * inchi key: ** InChIKey=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5398 RXN0-5398] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/4.2.1.70 EC-4.2.1.70]
+
** InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M
 +
* common name:
 +
** phenylacetylglycine
 +
* molecular weight:
 +
** 192.194   
 
* Synonym(s):
 
* Synonym(s):
 +
** phenaceturic acid
 +
** phenacetylglycine
 +
** N-phenacetylglycine
 +
** N-phenylacetylglycine
 +
** N-(phenylacetyl)glycine
 +
** glycine, N-(phenylacetyl)-
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[URACIL]][c] '''+''' 1 [[CPD-15317]][c] '''<=>''' 1 [[PSEUDOURIDINE-5-P]][c] '''+''' 1 [[WATER]][c]
+
* [[RXN-10821]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 uracil[c] '''+''' 1 D-ribofuranose 5-phosphate[c] '''<=>''' 1 pseudouridine 5'-phosphate[c] '''+''' 1 H2O[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_6094]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6019]], pseudouridine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6019 PWY-6019]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18337 18337]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4229702 4229702]
−
* LIGAND-RXN:
+
* CHEMSPIDER:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01055 R01055]
+
** [http://www.chemspider.com/Chemical-Structure.3438658.html 3438658]
−
* UNIPROT:
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/Q9JWF1 Q9JWF1]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60874 60874]
−
** [http://www.uniprot.org/uniprot/Q9JTX5 Q9JTX5]
+
{{#set: smiles=C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)}}
−
** [http://www.uniprot.org/uniprot/Q9PPJ9 Q9PPJ9]
+
{{#set: inchi key=InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M}}
−
** [http://www.uniprot.org/uniprot/Q9CGH0 Q9CGH0]
+
{{#set: common name=phenylacetylglycine}}
−
** [http://www.uniprot.org/uniprot/Q9CI80 Q9CI80]
+
{{#set: molecular weight=192.194    }}
−
** [http://www.uniprot.org/uniprot/Q9JX44 Q9JX44]
+
{{#set: common name=phenaceturic acid|phenacetylglycine|N-phenacetylglycine|N-phenylacetylglycine|N-(phenylacetyl)glycine|glycine, N-(phenylacetyl)-}}
−
** [http://www.uniprot.org/uniprot/Q9V1A5 Q9V1A5]
+
{{#set: produced by=RXN-10821}}
−
** [http://www.uniprot.org/uniprot/Q9PP96 Q9PP96]
+
−
** [http://www.uniprot.org/uniprot/Q9PN18 Q9PN18]
+
−
** [http://www.uniprot.org/uniprot/Q9PJ89 Q9PJ89]
+
−
** [http://www.uniprot.org/uniprot/Q9PNJ2 Q9PNJ2]
+
−
** [http://www.uniprot.org/uniprot/Q9PLW9 Q9PLW9]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: ec number=EC-4.2.1.70}}
+
−
{{#set: gene associated=Tiso_gene_6094}}
+
−
{{#set: in pathway=PWY-6019}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=esiliculosus}}
+

Revision as of 17:15, 10 January 2018

Metabolite CPD-11715

  • smiles:
    • C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)
  • inchi key:
    • InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M
  • common name:
    • phenylacetylglycine
  • molecular weight:
    • 192.194
  • Synonym(s):
    • phenaceturic acid
    • phenacetylglycine
    • N-phenacetylglycine
    • N-phenylacetylglycine
    • N-(phenylacetyl)glycine
    • glycine, N-(phenylacetyl)-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-2006&oldid=16881"