Difference between revisions of "PSEUDOURIDINE-5-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_14062 == * left end position: ** 1133 * transcription direction: ** NEGATIVE * right end position: ** 5744 * centisome position: ** 19.3015...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] == * smiles: ** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O * inchi...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_14062 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] ==
−
* left end position:
+
* smiles:
−
** 1133
+
** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M
−
* right end position:
+
* common name:
−
** 5744
+
** melibionate
−
* centisome position:
+
* molecular weight:
−
** 19.301533    
+
** 357.291    
 
* Synonym(s):
 
* Synonym(s):
 +
** melibionic acid
 +
** 6-O-α-D-galactopyranosyl-D-gluconic acid
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-12086]]
+
* [[RXN-17754]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-12579]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
* [[TRIACYLGLYCEROL-LIPASE-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[LIPAS-PWY]]
+
−
* [[PWY-6857]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1133}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202771 25202771]
−
{{#set: right end position=5744}}
+
* CHEBI:
−
{{#set: centisome position=19.301533   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75299 75299]
−
{{#set: reaction associated=RXN-12086|RXN-12579|TRIACYLGLYCEROL-LIPASE-RXN}}
+
{{#set: smiles=C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O}}
−
{{#set: pathway associated=LIPAS-PWY|PWY-6857}}
+
{{#set: inchi key=InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M}}
 +
{{#set: common name=melibionate}}
 +
{{#set: molecular weight=357.291   }}
 +
{{#set: common name=melibionic acid|6-O-α-D-galactopyranosyl-D-gluconic acid}}
 +
{{#set: consumed by=RXN-17754}}

Revision as of 17:15, 10 January 2018

Metabolite CPD-3801

  • smiles:
    • C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O
  • inchi key:
    • InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M
  • common name:
    • melibionate
  • molecular weight:
    • 357.291
  • Synonym(s):
    • melibionic acid
    • 6-O-α-D-galactopyranosyl-D-gluconic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PSEUDOURIDINE-5-P&oldid=16887"