Difference between revisions of "CPD-6972"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6972 CPD-6972] == * smiles: ** CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)...")
 
(Created page with "Category:Gene == Gene Tiso_gene_16028 == * left end position: ** 1941 * transcription direction: ** POSITIVE * right end position: ** 3492 * centisome position: ** 41.8228...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6972 CPD-6972] ==
+
== Gene Tiso_gene_16028 ==
−
* smiles:
+
* left end position:
−
** CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O
+
** 1941
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KVAQAPQXOXTRAE-UHFFFAOYSA-I
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA
+
** 3492
−
* molecular weight:
+
* centisome position:
−
** 966.676    
+
** 41.822884    
 
* Synonym(s):
 
* Synonym(s):
−
** succinylbenzoyl-CoA
 
−
** 2-succinylbenzoyl-CoA
 
−
** 2-(3'-carboxypropionyl)benzoyl-CoA
 
−
** o-succinylbenzoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[NAPHTHOATE-SYN-RXN]]
+
* [[PEROXID-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** [[pantograph]]-[[esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-12440]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
* [[RXN-14240]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[RXN-15288]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[RXN-3521]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
* [[RXN-8635]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7214]]
 +
* [[PWY-6960]]
 +
* [[PWY-5461]]
 +
* [[PWY-7445]]
 +
* [[PWY-6959]]
 +
* [[PWY-6961]]
 +
* [[PWY-2261]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1941}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245100 25245100]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3492}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15509 15509]
+
{{#set: centisome position=41.822884   }}
−
* BIGG : sbzcoa
+
{{#set: reaction associated=PEROXID-RXN|RXN-12440|RXN-14240|RXN-15288|RXN-3521|RXN-8635}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7214|PWY-6960|PWY-5461|PWY-7445|PWY-6959|PWY-6961|PWY-2261}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03160 C03160]
+
−
{{#set: smiles=CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O}}
+
−
{{#set: inchi key=InChIKey=KVAQAPQXOXTRAE-UHFFFAOYSA-I}}
+
−
{{#set: common name=4-(2'-carboxyphenyl)-4-oxobutyryl-CoA}}
+
−
{{#set: molecular weight=966.676   }}
+
−
{{#set: common name=succinylbenzoyl-CoA|2-succinylbenzoyl-CoA|2-(3'-carboxypropionyl)benzoyl-CoA|o-succinylbenzoyl-CoA}}
+
−
{{#set: consumed by=NAPHTHOATE-SYN-RXN}}
+

Revision as of 18:15, 10 January 2018

Gene Tiso_gene_16028

  • left end position:
    • 1941
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3492
  • centisome position:
    • 41.822884
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-6972&oldid=16900"