Difference between revisions of "Tiso gene 3166"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * smiles: ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) * in...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALA-tRNAs ALA-tRNAs] == * common name: ** a tRNAala * Synonym(s): ** TRNA(ALA) == Reaction(s)...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALA-tRNAs ALA-tRNAs] ==
* smiles:
+
** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))
+
* inchi key:
+
** InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N
+
 
* common name:
 
* common name:
** 4-methylumbelliferyl glucoside
+
** a tRNAala
* molecular weight:
+
** 338.313   
+
 
* Synonym(s):
 
* Synonym(s):
** 4-MU-glucoside
+
** TRNA(ALA)
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10769]]
+
* [[ALANINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB02639
+
{{#set: common name=a tRNAala}}
* PUBCHEM:
+
{{#set: common name=TRNA(ALA)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=2733779 2733779]
+
{{#set: consumed by=ALANINE--TRNA-LIGASE-RXN}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.2015550.html 2015550]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=91117 91117]
+
{{#set: smiles=CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))}}
+
{{#set: inchi key=InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N}}
+
{{#set: common name=4-methylumbelliferyl glucoside}}
+
{{#set: molecular weight=338.313    }}
+
{{#set: common name=4-MU-glucoside}}
+
{{#set: consumed by=RXN-10769}}
+

Revision as of 17:15, 10 January 2018

Metabolite ALA-tRNAs

  • common name:
    • a tRNAala
  • Synonym(s):
    • TRNA(ALA)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links