Difference between revisions of "RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48."
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == * smiles: ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) * inchi key: ** In...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Prime-Phosphate-Terminated-RNAs 3-Prime-Phosphate-Terminated-RNAs] == * common name: ** an [R...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Prime-Phosphate-Terminated-RNAs 3-Prime-Phosphate-Terminated-RNAs] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an [RNA]-3'-(3'-phospho-ribonucleoside) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a RNA with 3' phosphate |
+ | ** a 3'-phosphate-terminated RNA | ||
+ | ** an RNA 3'-terminal-phosphate | ||
+ | ** a 3'-phospho-[RNA] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RNA-3-PHOSPHATE-CYCLASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=an [RNA]-3'-(3'-phospho-ribonucleoside)}} | |
− | + | {{#set: common name=a RNA with 3' phosphate|a 3'-phosphate-terminated RNA|an RNA 3'-terminal-phosphate|a 3'-phospho-[RNA]}} | |
− | + | {{#set: consumed by=RNA-3-PHOSPHATE-CYCLASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: consumed | + |
Revision as of 17:15, 10 January 2018
Contents
Metabolite 3-Prime-Phosphate-Terminated-RNAs
- common name:
- an [RNA]-3'-(3'-phospho-ribonucleoside)
- Synonym(s):
- a RNA with 3' phosphate
- a 3'-phosphate-terminated RNA
- an RNA 3'-terminal-phosphate
- a 3'-phospho-[RNA]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an [RNA]-3'-(3'-phospho-ribonucleoside)" cannot be used as a page name in this wiki.
"a 3'-phospho-[RNA" cannot be used as a page name in this wiki.