Difference between revisions of "CPD-558"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15616 CPD-15616] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=BJHIKXHVC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15616 CPD-15616] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)C(=O)C(O)C(O)C(O)CO |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N |
* common name: | * common name: | ||
− | ** | + | ** keto-L-sorbose |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 180.157 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14811]] | ||
+ | * [[L-IDITOL-2-DEHYDROGENASE-RXN]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6904 6904] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=13172 13172] |
− | * | + | * METABOLIGHTS : MTBLC13172 |
− | + | {{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}} | |
− | + | {{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N}} | |
− | {{#set: smiles= | + | {{#set: common name=keto-L-sorbose}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=180.157 }} |
− | {{#set: common name= | + | {{#set: consumed or produced by=RXN-14811|L-IDITOL-2-DEHYDROGENASE-RXN}} |
− | {{#set: molecular weight= | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:17, 10 January 2018
Contents
Metabolite CPD-15616
- smiles:
- C(O)C(=O)C(O)C(O)C(O)CO
- inchi key:
- InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N
- common name:
- keto-L-sorbose
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links