Difference between revisions of "Tiso gene 17704"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-134 CPD1F-134] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C))...")
 
(Created page with "Category:Gene == Gene Tiso_gene_11850 == * left end position: ** 5768 * transcription direction: ** NEGATIVE * right end position: ** 7441 * centisome position: ** 77.1019...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-134 CPD1F-134] ==
+
== Gene Tiso_gene_11850 ==
−
* smiles:
+
* left end position:
−
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** 5768
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** gibberellin A9
+
** 7441
−
* molecular weight:
+
* centisome position:
−
** 315.388    
+
** 77.10199    
 
* Synonym(s):
 
* Synonym(s):
−
** C19-GAs
 
−
** closed lactone gibberellin skeleton
 
−
** C19 skeleton
 
−
** C19-GA skeleton
 
−
** C19-gibberellin skeleton
 
−
** GA9
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN1F-165]]
+
* [[2.1.1.143-RXN]]
−
* [[RXN-171]]
+
** in-silico_annotation
−
== Reaction(s) known to produce the compound ==
+
***automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* [[RXN-4021]]
 +
** in-silico_annotation
 +
***automated-name-match
 +
** [[pantograph]]-[[athaliana]]
 +
== Pathways associated ==
 +
* [[PWY-2541]]
 +
* [[PWY-7155]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5768}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244370 25244370]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=7441}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73255 73255]
+
{{#set: centisome position=77.10199   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=2.1.1.143-RXN|RXN-4021}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11863 C11863]
+
{{#set: pathway associated=PWY-2541|PWY-7155}}
−
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M}}
+
−
{{#set: common name=gibberellin A9}}
+
−
{{#set: molecular weight=315.388   }}
+
−
{{#set: common name=C19-GAs|closed lactone gibberellin skeleton|C19 skeleton|C19-GA skeleton|C19-gibberellin skeleton|GA9}}
+
−
{{#set: consumed by=RXN1F-165|RXN-171}}
+

Revision as of 18:17, 10 January 2018

Gene Tiso_gene_11850

  • left end position:
    • 5768
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 7441
  • centisome position:
    • 77.10199
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17704&oldid=17090"