Difference between revisions of "Tiso gene 9234"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL] == * smiles: ** CC(C)=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCYTPT DCYTPT] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:deoxynucleoside 5'-phosphotra...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCYTPT DCYTPT] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N
+
 
* common name:
 
* common name:
−
** 5α-cholesta-7,24-dien-3β-ol
+
** ATP:deoxynucleoside 5'-phosphotransferase
−
* molecular weight:
+
−
** 384.644   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-26]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[DEOXYCYTIDINE]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[ADP]][c] '''+''' 1.0 [[DCMP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 2'-deoxycytidine[c] '''+''' 1.0 ATP[c] '''=>''' 1.0 H+[c] '''+''' 1.0 ADP[c] '''+''' 1.0 dCMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_416]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459827 5459827]
+
{{#set: common name=ATP:deoxynucleoside 5'-phosphotransferase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_416}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16290 16290]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05439 C05439]
+
{{#set: reconstruction tool=pantograph}}
−
* HMDB : HMDB06842
+
{{#set: reconstruction source=creinhardtii}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))}}
+
−
{{#set: inchi key=InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N}}
+
−
{{#set: common name=5α-cholesta-7,24-dien-3β-ol}}
+
−
{{#set: molecular weight=384.644    }}
+
−
{{#set: consumed by=RXN66-26}}
+

Revision as of 17:17, 10 January 2018

Reaction DCYTPT

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ATP:deoxynucleoside 5'-phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 2'-deoxycytidine[c] + 1.0 ATP[c] => 1.0 H+[c] + 1.0 ADP[c] + 1.0 dCMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9234&oldid=17098"