Difference between revisions of "Tiso gene 20054"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FACOAE1839Z12Z15Z FACOAE1839Z12Z15Z] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha-Linol...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == * smiles: ** C1(=C(C([O-])=O)NC(NC(=O)1)=O) * inchi key: ** InChIKey=PXQPEW...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == |
− | * | + | * smiles: |
− | ** | + | ** C1(=C(C([O-])=O)NC(NC(=O)1)=O) |
+ | * inchi key: | ||
+ | ** InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** orotate |
+ | * molecular weight: | ||
+ | ** 155.09 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** orotic acid | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN0-6490]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN0-6491]] | |
− | * | + | * [[RXN0-6554]] |
− | + | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] | |
− | + | * [[RXN-9929]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | * [[OROPRIBTRANS-RXN]] |
− | + | * [[orPRT]] | |
− | == | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 65-86-1 |
− | {{#set: | + | * METABOLIGHTS : MTBLC30839 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1492348 1492348] |
− | {{#set: | + | * HMDB : HMDB00226 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00295 C00295] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30839 30839] | ||
+ | * BIGG : orot | ||
+ | {{#set: smiles=C1(=C(C([O-])=O)NC(NC(=O)1)=O)}} | ||
+ | {{#set: inchi key=InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=orotate}} | ||
+ | {{#set: molecular weight=155.09 }} | ||
+ | {{#set: common name=orotic acid}} | ||
+ | {{#set: consumed by=RXN0-6490}} | ||
+ | {{#set: produced by=RXN0-6491|RXN0-6554|DIHYDROOROTATE-DEHYDROGENASE-RXN|RXN-9929}} | ||
+ | {{#set: consumed or produced by=OROPRIBTRANS-RXN|orPRT}} |
Revision as of 17:18, 10 January 2018
Contents
Metabolite OROTATE
- smiles:
- C1(=C(C([O-])=O)NC(NC(=O)1)=O)
- inchi key:
- InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M
- common name:
- orotate
- molecular weight:
- 155.09
- Synonym(s):
- orotic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 65-86-1
- METABOLIGHTS : MTBLC30839
- PUBCHEM:
- HMDB : HMDB00226
- LIGAND-CPD:
- CHEBI:
- BIGG : orot
"C1(=C(C([O-])=O)NC(NC(=O)1)=O)" cannot be used as a page name in this wiki.