Difference between revisions of "Tiso gene 11396"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_20054 == * left end position: ** 8 * transcription direction: ** POSITIVE * right end position: ** 723 * centisome position: ** 0.44469148...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] == * smiles: ** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_20054 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] ==
−
* left end position:
+
* smiles:
−
** 8
+
** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N
−
* right end position:
+
* common name:
−
** 723
+
** linustatin
−
* centisome position:
+
* molecular weight:
−
** 0.44469148    
+
** 409.389    
 
* Synonym(s):
 
* Synonym(s):
−
** FNR
+
** propanenitrile
 +
** [2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[1.18.1.2-RXN]]
+
* [[RXN-13602]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** experimental_annotation
+
−
***ec-number
+
−
* [[RXN-17897]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
** experimental_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-7230]]
+
−
* [[PWY-101]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=8}}
+
* LIGAND-CPD:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08333 C08333]
−
{{#set: right end position=723}}
+
* CHEBI:
−
{{#set: centisome position=0.44469148   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6483 6483]
−
{{#set: common name=FNR}}
+
* PUBCHEM:
−
{{#set: reaction associated=1.18.1.2-RXN|RXN-17897}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119301 119301]
−
{{#set: pathway associated=PWY-7230|PWY-101}}
+
{{#set: smiles=CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}}
 +
{{#set: inchi key=InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N}}
 +
{{#set: common name=linustatin}}
 +
{{#set: molecular weight=409.389   }}
 +
{{#set: common name=propanenitrile|[2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]}}
 +
{{#set: consumed by=RXN-13602}}

Revision as of 17:18, 10 January 2018

Metabolite CPD-14594

  • smiles:
    • CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
  • inchi key:
    • InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N
  • common name:
    • linustatin
  • molecular weight:
    • 409.389
  • Synonym(s):
    • propanenitrile
    • [2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11396&oldid=17183"