Difference between revisions of "CPD-19155"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2123 == * left end position: ** 504 * transcription direction: ** NEGATIVE * right end position: ** 6808 * centisome position: ** 2.4570982...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OBTUSIFOLIOL OBTUSIFOLIOL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OBTUSIFOLIOL OBTUSIFOLIOL] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=MMNYKQIDRZNIKT-VSADUBDNSA-N |
| − | * | + | * common name: |
| − | ** | + | ** obtusifoliol |
| − | * | + | * molecular weight: |
| − | ** | + | ** 426.724 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 4α,14α-dimethyl-5α-ergosta-8,24(28)-dien-3β-ol | ||
| + | ** 4α,14α-dimethyl-24-methylene-5α-cholesta-8-en-3β-ol | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[OBFOOLor]] |
| − | + | * [[1.14.13.70-RXN]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[CYCLOEUCALENOL-CYCLOISOMERASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65252 65252] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17791 17791] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01943 C01943] |
| + | * HMDB : HMDB01242 | ||
| + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}} | ||
| + | {{#set: inchi key=InChIKey=MMNYKQIDRZNIKT-VSADUBDNSA-N}} | ||
| + | {{#set: common name=obtusifoliol}} | ||
| + | {{#set: molecular weight=426.724 }} | ||
| + | {{#set: common name=4α,14α-dimethyl-5α-ergosta-8,24(28)-dien-3β-ol|4α,14α-dimethyl-24-methylene-5α-cholesta-8-en-3β-ol}} | ||
| + | {{#set: consumed by=OBFOOLor|1.14.13.70-RXN}} | ||
| + | {{#set: produced by=CYCLOEUCALENOL-CYCLOISOMERASE-RXN}} | ||
Revision as of 17:18, 10 January 2018
Contents
Metabolite OBTUSIFOLIOL
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=MMNYKQIDRZNIKT-VSADUBDNSA-N
- common name:
- obtusifoliol
- molecular weight:
- 426.724
- Synonym(s):
- 4α,14α-dimethyl-5α-ergosta-8,24(28)-dien-3β-ol
- 4α,14α-dimethyl-24-methylene-5α-cholesta-8-en-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.
