Difference between revisions of "Beta-D-Mannosides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14899 RXN-14899] == * direction: ** LEFT-TO-RIGHT * common name: ** phosphatidylcholine phospho...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBINAMIDE COBINAMIDE] == * smiles: ** CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14899 RXN-14899] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBINAMIDE COBINAMIDE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))
 +
* inchi key:
 +
** InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M
 
* common name:
 
* common name:
−
** phosphatidylcholine phospholipase
+
** cobinamide
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.1.1 EC-3.1.1]
+
** 990.096   
 
* Synonym(s):
 
* Synonym(s):
 +
** Cbi
 +
** cobyrinic acid a,c-diamide
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[BTUR2-RXN]]
−
** 2 [[WATER]][c] '''+''' 1 [[PHOSPHATIDYLCHOLINE]][c] '''=>''' 2 [[PROTON]][c] '''+''' 2 [[Carboxylates]][c] '''+''' 1 [[L-1-GLYCERO-PHOSPHORYLCHOLINE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 H2O[c] '''+''' 1 a phosphatidylcholine[c] '''=>''' 2 H+[c] '''+''' 2 a carboxylate[c] '''+''' 1 sn-glycero-3-phosphocholine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_15692]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_2505]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_334]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_20565]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-7367]], phosphatidylcholine resynthesis via glycerophosphocholine: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7367 PWY-7367]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 1867-62-5
−
{{#set: common name=phosphatidylcholine phospholipase}}
+
* PUBCHEM:
−
{{#set: ec number=EC-3.1.1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820010 91820010]
−
{{#set: gene associated=Tiso_gene_15692|Tiso_gene_2505|Tiso_gene_334|Tiso_gene_20565}}
+
* HMDB : HMDB06902
−
{{#set: in pathway=PWY-7367}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05774 C05774]
−
{{#set: reconstruction tool=pantograph}}
+
* CHEBI:
−
{{#set: reconstruction source=esiliculosus}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28956 28956]
 +
* BIGG : cbi
 +
{{#set: smiles=CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))}}
 +
{{#set: inchi key=InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M}}
 +
{{#set: common name=cobinamide}}
 +
{{#set: molecular weight=990.096    }}
 +
{{#set: common name=Cbi|cobyrinic acid a,c-diamide}}
 +
{{#set: consumed by=BTUR2-RXN}}

Revision as of 17:19, 10 January 2018

Metabolite COBINAMIDE

  • smiles:
    • CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))
  • inchi key:
    • InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M
  • common name:
    • cobinamide
  • molecular weight:
    • 990.096
  • Synonym(s):
    • Cbi
    • cobyrinic acid a,c-diamide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 1867-62-5
  • PUBCHEM:
  • HMDB : HMDB06902
  • LIGAND-CPD:
  • CHEBI:
  • BIGG : cbi
"CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Beta-D-Mannosides&oldid=17215"