Difference between revisions of "Tiso gene 14664"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13607 RXN-13607] == * direction: ** LEFT-TO-RIGHT * common name: ** exostosin_family_protein *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * smiles: ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) * inchi key...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == |
− | * | + | * smiles: |
− | ** | + | ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) |
+ | * inchi key: | ||
+ | ** InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O | ||
* common name: | * common name: | ||
− | ** | + | ** queuine |
− | * | + | * molecular weight: |
− | ** | + | ** 278.29 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine | ||
+ | ** base Q | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]] | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289319 86289319] | |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77674 77674] |
− | {{#set: | + | * HMDB : HMDB01495 |
− | {{#set: | + | {{#set: smiles=C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O}} |
− | {{#set: | + | {{#set: common name=queuine}} |
+ | {{#set: molecular weight=278.29 }} | ||
+ | {{#set: common name=7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine|base Q}} | ||
+ | {{#set: consumed or produced by=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}} |
Revision as of 18:19, 10 January 2018
Contents
Metabolite QUEUINE
- smiles:
- C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))
- inchi key:
- InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O
- common name:
- queuine
- molecular weight:
- 278.29
- Synonym(s):
- 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine
- base Q
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))" cannot be used as a page name in this wiki.