Difference between revisions of "Tiso gene 9833"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == * smiles: ** C(CC(C(=O)[O-])[N+])ONC(N)=O * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MI-HEXAKISPHOSPHATE MI-HEXAKISPHOSPHATE] == * smiles: ** C1(OP([O-])([O-])=O)(C(OP([O-])(=O)[O-...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MI-HEXAKISPHOSPHATE MI-HEXAKISPHOSPHATE] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C1(OP([O-])([O-])=O)(C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(OP([O-])([O-])=O)1) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=IMQLKJBTEOYOSI-GPIVLXJGSA-B |
* common name: | * common name: | ||
| − | ** | + | ** phytate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 647.942 |
* Synonym(s): | * Synonym(s): | ||
| + | ** phytic acid | ||
| + | ** 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate | ||
| + | ** myo-inositol hexakisphosphate | ||
| + | ** D-myo-Inositol 1,2,3,4,5,6-hexakisphosphate | ||
| + | ** myo-Inositol 1,2,3,4,5,6-hexakisphosphate | ||
| + | ** Inositol 1,2,3,4,5,6-hexakisphosphate | ||
| + | ** InsP6 | ||
| + | ** 1D-myo-Inositol hexakisphosphate | ||
| + | ** IP6 | ||
| + | ** inositol hexaphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7163]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * METABOLIGHTS : MTBLC58130 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21584050 21584050] |
| − | * HMDB : | + | * HMDB : HMDB03502 |
| − | {{#set: smiles=C( | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01204 C01204] |
| − | {{#set: common name= | + | * CHEMSPIDER: |
| − | {{#set: molecular weight= | + | ** [http://www.chemspider.com/Chemical-Structure.10618952.html 10618952] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58130 58130] | ||
| + | * BIGG : minohp | ||
| + | {{#set: smiles=C1(OP([O-])([O-])=O)(C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(OP([O-])([O-])=O)1)}} | ||
| + | {{#set: inchi key=InChIKey=IMQLKJBTEOYOSI-GPIVLXJGSA-B}} | ||
| + | {{#set: common name=phytate}} | ||
| + | {{#set: molecular weight=647.942 }} | ||
| + | {{#set: common name=phytic acid|1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate|myo-inositol hexakisphosphate|D-myo-Inositol 1,2,3,4,5,6-hexakisphosphate|myo-Inositol 1,2,3,4,5,6-hexakisphosphate|Inositol 1,2,3,4,5,6-hexakisphosphate|InsP6|1D-myo-Inositol hexakisphosphate|IP6|inositol hexaphosphate}} | ||
| + | {{#set: produced by=RXN-7163}} | ||
Revision as of 18:20, 10 January 2018
Contents
Metabolite MI-HEXAKISPHOSPHATE
- smiles:
- C1(OP([O-])([O-])=O)(C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(OP([O-])([O-])=O)1)
- inchi key:
- InChIKey=IMQLKJBTEOYOSI-GPIVLXJGSA-B
- common name:
- phytate
- molecular weight:
- 647.942
- Synonym(s):
- phytic acid
- 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate
- myo-inositol hexakisphosphate
- D-myo-Inositol 1,2,3,4,5,6-hexakisphosphate
- myo-Inositol 1,2,3,4,5,6-hexakisphosphate
- Inositol 1,2,3,4,5,6-hexakisphosphate
- InsP6
- 1D-myo-Inositol hexakisphosphate
- IP6
- inositol hexaphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC58130
- PUBCHEM:
- HMDB : HMDB03502
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : minohp
"C1(OP([O-])([O-])=O)(C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(OP([O-])([O-])=O)1)" cannot be used as a page name in this wiki.
