Difference between revisions of "RXN0-5222"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glucomannans Glucomannans] == * common name: ** a glucomannan * Synonym(s): == Reaction(s) kno...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] == |
| + | * smiles: | ||
| + | ** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4) | ||
| + | * inchi key: | ||
| + | ** InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** OPC4-3-hydroxyacyl-CoA |
| + | * molecular weight: | ||
| + | ** 999.813 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10703]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10705]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: consumed | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237301 44237301] |
| + | {{#set: smiles=CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}} | ||
| + | {{#set: inchi key=InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J}} | ||
| + | {{#set: common name=OPC4-3-hydroxyacyl-CoA}} | ||
| + | {{#set: molecular weight=999.813 }} | ||
| + | {{#set: consumed by=RXN-10703}} | ||
| + | {{#set: produced by=RXN-10705}} | ||
Revision as of 17:20, 10 January 2018
Contents
Metabolite CPD-11527
- smiles:
- CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
- inchi key:
- InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J
- common name:
- OPC4-3-hydroxyacyl-CoA
- molecular weight:
- 999.813
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)" cannot be used as a page name in this wiki.
