Difference between revisions of "STEAROYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11403 CPD-11403] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C(I)=C2)) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.67-RXN 2.4.1.67-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.67-RXN 2.4.1.67-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.67 EC-2.4.1.67] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD-458]][c] '''+''' 1 [[CPD-1099]][c] '''<=>''' 1 [[CPD-170]][c] '''+''' 1 [[MYO-INOSITOL]][c] |
− | == | + | * With common name(s): |
− | == | + | ** 1 galactinol[c] '''+''' 1 raffinose[c] '''<=>''' 1 stachyose[c] '''+''' 1 myo-inositol[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_8673]] | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | * [[Tiso_gene_16101]] | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5337]], stachyose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5337 PWY-5337] | ||
+ | ** '''2''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[creinhardtii]] | ||
+ | *** [[athaliana]] | ||
+ | *** [[esiliculosus]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20776 20776] |
− | {{#set: | + | * LIGAND-RXN: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03418 R03418] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: | + | {{#set: ec number=EC-2.4.1.67}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_8673|Tiso_gene_16101}} |
− | {{#set: | + | {{#set: in pathway=PWY-5337}} |
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction tool=pantograph}} | ||
+ | {{#set: reconstruction source=creinhardtii|athaliana|esiliculosus}} |
Revision as of 18:20, 10 January 2018
Contents
Reaction 2.4.1.67-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-458[c] + 1 CPD-1099[c] <=> 1 CPD-170[c] + 1 MYO-INOSITOL[c]
- With common name(s):
- 1 galactinol[c] + 1 raffinose[c] <=> 1 stachyose[c] + 1 myo-inositol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
External links