Difference between revisions of "Tiso gene 4087"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14726 RXN-14726] == * direction: ** LEFT-TO-RIGHT * common name: ** probable_nitrile_hydratase...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9459 CPD-9459] == * smiles: ** CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14726 RXN-14726] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9459 CPD-9459] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C
 +
* inchi key:
 +
** InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M
 
* common name:
 
* common name:
−
** probable_nitrile_hydratase
+
** oleanolate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/4.2.1.84 EC-4.2.1.84]
+
** 455.699   
 
* Synonym(s):
 
* Synonym(s):
 +
** oleanolic acid
 +
** oleanic acid
 +
** caryophyllin
 +
** 3-beta-Hydroxyolean-12-en-28-oic acid
 +
** oleonolic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-9000]]
−
** 1 [[CPD-12327]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[BUTYRAMIDE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 n-butyronitrile[c] '''+''' 1 H2O[c] '''=>''' 1 butyramide[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_4032]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=probable_nitrile_hydratase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11865404 11865404]
−
{{#set: ec number=EC-4.2.1.84}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Tiso_gene_4032}}
+
** [http://www.chemspider.com/Chemical-Structure.10039737.html 10039737]
−
{{#set: in pathway=}}
+
* CHEBI:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=82828 82828]
−
{{#set: reconstruction tool=pathwaytools}}
+
* METABOLIGHTS : MTBLC37659
−
{{#set: reconstruction source=in-silico_annotation}}
+
* HMDB : HMDB02364
 +
{{#set: smiles=CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C}}
 +
{{#set: inchi key=InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M}}
 +
{{#set: common name=oleanolate}}
 +
{{#set: molecular weight=455.699    }}
 +
{{#set: common name=oleanolic acid|oleanic acid|caryophyllin|3-beta-Hydroxyolean-12-en-28-oic acid|oleonolic acid}}
 +
{{#set: consumed by=RXN-9000}}

Revision as of 17:20, 10 January 2018

Metabolite CPD-9459

  • smiles:
    • CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C
  • inchi key:
    • InChIKey=MIJYXULNPSFWEK-GTOFXWBISA-M
  • common name:
    • oleanolate
  • molecular weight:
    • 455.699
  • Synonym(s):
    • oleanolic acid
    • oleanic acid
    • caryophyllin
    • 3-beta-Hydroxyolean-12-en-28-oic acid
    • oleonolic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC3(C[CH]4(C2(=CC[CH]5(C1(CCC(C([CH]1CCC(C2(CCC(CC3)4C([O-])=O)C)5C)(C)C)O)C))))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4087&oldid=17353"