Difference between revisions of "1.1.4.1-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VANILLIN VANILLIN] == * smiles: ** COC1(C(=CC=C([CH]=O)C=1)O) * inchi key: ** InChIKey=MWOOGOJB...") |
(Created page with "Category:Gene == Gene Tiso_gene_1548 == * left end position: ** 7610 * transcription direction: ** NEGATIVE * right end position: ** 8755 * centisome position: ** 32.51719...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1548 == |
− | * | + | * left end position: |
− | ** | + | ** 7610 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 8755 |
− | * | + | * centisome position: |
− | ** | + | ** 32.517197 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
− | == | + | ***ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7610}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=8755}} | |
− | + | {{#set: centisome position=32.517197 }} | |
− | + | {{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:20, 10 January 2018
Gene Tiso_gene_1548
- left end position:
- 7610
- transcription direction:
- NEGATIVE
- right end position:
- 8755
- centisome position:
- 32.517197
- Synonym(s):
Reactions associated
- TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation