Difference between revisions of "Tiso gene 11824"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_17381 == * Synonym(s): == Reactions associated == * 1.18.1.2-RXN ** pantograph-esiliculosus * RXN-17897 ** pantograph-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_17381 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] ==
 +
* smiles:
 +
** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
 +
* inchi key:
 +
** InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
 +
* common name:
 +
** 24-methylenecycloartanol
 +
* molecular weight:
 +
** 440.751   
 
* Synonym(s):
 
* Synonym(s):
 +
** 24(28)-methylenecycloartanol
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[1.18.1.2-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-4021]]
* [[RXN-17897]]
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[athaliana]]
+
== Pathways associated ==
+
* [[PWY-7230]]
+
* [[PWY-101]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=1.18.1.2-RXN|RXN-17897}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-7230|PWY-101}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21157981 21157981]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C08830 C08830]
 +
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
 +
{{#set: inchi key=InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N}}
 +
{{#set: common name=24-methylenecycloartanol}}
 +
{{#set: molecular weight=440.751    }}
 +
{{#set: common name=24(28)-methylenecycloartanol}}
 +
{{#set: produced by=RXN-4021}}

Revision as of 17:21, 10 January 2018

Metabolite CPD-696

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
  • inchi key:
    • InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
  • common name:
    • 24-methylenecycloartanol
  • molecular weight:
    • 440.751
  • Synonym(s):
    • 24(28)-methylenecycloartanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))" cannot be used as a page name in this wiki.