Difference between revisions of "1-KETO-2-METHYLVALERATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_4139 == * left end position: ** 2802 * transcription direction: ** POSITIVE * right end position: ** 3987 * centisome position: ** 18.22676...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPATE 3-KETO-ADIPATE] == * smiles: ** C(=O)([O-])CC(=O)CCC(=O)[O-] * inchi key: ** InC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_4139 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPATE 3-KETO-ADIPATE] ==
−
* left end position:
+
* smiles:
−
** 2802
+
** C(=O)([O-])CC(=O)CCC(=O)[O-]
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=RTGHRDFWYQHVFW-UHFFFAOYSA-L
−
* right end position:
+
* common name:
−
** 3987
+
** 3-oxoadipate
−
* centisome position:
+
* molecular weight:
−
** 18.22676    
+
** 158.11    
 
* Synonym(s):
 
* Synonym(s):
 +
** β-ketoadipate
 +
** 3-ketoadipate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[2.4.1.135-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[3-OXOADIPATE-ENOL-LACTONASE-RXN]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY-6557]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2802}}
+
* UM-BBD-CPD : c0100
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=3987}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459800 5459800]
−
{{#set: centisome position=18.22676   }}
+
* HMDB : HMDB00398
−
{{#set: reaction associated=2.4.1.135-RXN}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY-6557}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00846 C00846]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.4573571.html 4573571]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15775 15775]
 +
{{#set: smiles=C(=O)([O-])CC(=O)CCC(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=RTGHRDFWYQHVFW-UHFFFAOYSA-L}}
 +
{{#set: common name=3-oxoadipate}}
 +
{{#set: molecular weight=158.11   }}
 +
{{#set: common name=β-ketoadipate|3-ketoadipate}}
 +
{{#set: produced by=3-OXOADIPATE-ENOL-LACTONASE-RXN}}

Revision as of 17:21, 10 January 2018

Metabolite 3-KETO-ADIPATE

  • smiles:
    • C(=O)([O-])CC(=O)CCC(=O)[O-]
  • inchi key:
    • InChIKey=RTGHRDFWYQHVFW-UHFFFAOYSA-L
  • common name:
    • 3-oxoadipate
  • molecular weight:
    • 158.11
  • Synonym(s):
    • β-ketoadipate
    • 3-ketoadipate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CC(=O)CCC(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=1-KETO-2-METHYLVALERATE&oldid=17417"