Difference between revisions of "CPD-8575"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] == * smiles: ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-phospho-L-seryl-tRNASecs O-phospho-L-seryl-tRNASecs] == * common name: ** an O-phospho-L-sery...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-phospho-L-seryl-tRNASecs O-phospho-L-seryl-tRNASecs] ==
* smiles:
+
** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))
+
* inchi key:
+
** InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M
+
 
* common name:
 
* common name:
** 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide
+
** an O-phospho-L-seryl-[tRNASec]
* molecular weight:
+
** 826.095   
+
 
* Synonym(s):
 
* Synonym(s):
** 3,5,3'-triiodothyronine acyl β-D-glucuronide
+
** an O-phosphoseryl-[tRNAsec]
 +
** an O-phosphoseryl-tRNA[Ser]Sec
 +
** an O-phosphoseryl-[tRNA(Sec)]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10039]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10609]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-10038]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an O-phospho-L-seryl-[tRNASec]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659330 90659330]
+
{{#set: common name=an O-phosphoseryl-[tRNAsec]|an O-phosphoseryl-tRNA[Ser]Sec|an O-phosphoseryl-[tRNA(Sec)]}}
{{#set: smiles=C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))}}
+
{{#set: consumed by=RXN-10039}}
{{#set: inchi key=InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M}}
+
{{#set: consumed or produced by=RXN-10038}}
{{#set: common name=3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide}}
+
{{#set: molecular weight=826.095    }}
+
{{#set: common name=3,5,3'-triiodothyronine acyl β-D-glucuronide}}
+
{{#set: produced by=RXN-10609}}
+

Revision as of 17:21, 10 January 2018

Metabolite O-phospho-L-seryl-tRNASecs

  • common name:
    • an O-phospho-L-seryl-[tRNASec]
  • Synonym(s):
    • an O-phosphoseryl-[tRNAsec]
    • an O-phosphoseryl-tRNA[Ser]Sec
    • an O-phosphoseryl-[tRNA(Sec)]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an O-phospho-L-seryl-[tRNASec" cannot be used as a page name in this wiki.
  • "an O-phosphoseryl-[tRNAsec" cannot be used as a page name in this wiki.
  • "an O-phosphoseryl-tRNA[Ser]Sec" cannot be used as a page name in this wiki.
  • "an O-phosphoseryl-[tRNA(Sec)" cannot be used as a page name in this wiki.