Difference between revisions of "LIPIDADISACCHARIDESYNTH-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14249 == * left end position: ** 21 * transcription direction: ** NEGATIVE * right end position: ** 2054 * centisome position: ** 0.1932989...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == * smiles: ** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N |
| − | * | + | * common name: |
| − | ** | + | ** apo-4'-lycopenal |
| − | * | + | * molecular weight: |
| − | ** | + | ** 482.748 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-11999]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986183 50986183] |
| − | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N}} |
| − | {{#set: | + | {{#set: common name=apo-4'-lycopenal}} |
| + | {{#set: molecular weight=482.748 }} | ||
| + | {{#set: produced by=RXN-11999}} | ||
Revision as of 17:22, 10 January 2018
Contents
Metabolite CPD-12936
- smiles:
- CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O
- inchi key:
- InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N
- common name:
- apo-4'-lycopenal
- molecular weight:
- 482.748
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
