Difference between revisions of "GDPA"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_16302 == * left end position: ** 2491 * transcription direction: ** POSITIVE * right end position: ** 4422 * centisome position: ** 55.9147...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == * smiles: ** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O * inchi key: **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L |
− | * | + | * common name: |
− | ** | + | ** D-mannitol 1-phosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 260.137 |
* Synonym(s): | * Synonym(s): | ||
+ | ** mannitol-1-P | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[MANNITOL-1-PHOSPHATASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | * [[MANNPDEHYDROG-RXN]] |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 15806-48-1 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615341 23615341] |
− | {{#set: | + | * HMDB : HMDB01530 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00644 C00644] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.19951338.html 19951338] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61381 61381] | ||
+ | * BIGG : mnl1p | ||
+ | {{#set: smiles=C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O}} | ||
+ | {{#set: inchi key=InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L}} | ||
+ | {{#set: common name=D-mannitol 1-phosphate}} | ||
+ | {{#set: molecular weight=260.137 }} | ||
+ | {{#set: common name=mannitol-1-P}} | ||
+ | {{#set: consumed by=MANNITOL-1-PHOSPHATASE-RXN}} | ||
+ | {{#set: consumed or produced by=MANNPDEHYDROG-RXN}} |
Revision as of 18:22, 10 January 2018
Contents
Metabolite MANNITOL-1P
- smiles:
- C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O
- inchi key:
- InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L
- common name:
- D-mannitol 1-phosphate
- molecular weight:
- 260.137
- Synonym(s):
- mannitol-1-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 15806-48-1
- PUBCHEM:
- HMDB : HMDB01530
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : mnl1p
"C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O" cannot be used as a page name in this wiki.