Difference between revisions of "Tiso gene 1404"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10247 == * Synonym(s): == Reactions associated == * SULFITE-REDUCTASE-FERREDOXIN-RXN ** pantograph-athaliana ** pantograph...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_10247 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] ==
 +
* smiles:
 +
** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
 +
* inchi key:
 +
** InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
 +
* common name:
 +
** 14-hydroxylanosterol
 +
* molecular weight:
 +
** 442.724   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[SULFITE-REDUCTASE-FERREDOXIN-RXN]]
+
* [[RXN66-304]]
−
** [[pantograph]]-[[athaliana]]
+
== Reaction(s) known to produce the compound ==
−
** [[pantograph]]-[[synechocystis]]
+
* [[RXN66-303]]
−
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[SULFMETII-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: reaction associated=SULFITE-REDUCTASE-FERREDOXIN-RXN}}
+
* PUBCHEM:
−
{{#set: pathway associated=SULFMETII-PWY}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298935 22298935]
 +
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
 +
{{#set: inchi key=InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N}}
 +
{{#set: common name=14-hydroxylanosterol}}
 +
{{#set: molecular weight=442.724    }}
 +
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol}}
 +
{{#set: consumed by=RXN66-304}}
 +
{{#set: produced by=RXN66-303}}

Revision as of 17:22, 10 January 2018

Metabolite CPD-4568

  • smiles:
    • CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
  • inchi key:
    • InChIKey=DWVYYKFZEDMMPU-PUXRVUTHSA-N
  • common name:
    • 14-hydroxylanosterol
  • molecular weight:
    • 442.724
  • Synonym(s):
    • 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8,24-dien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1404&oldid=17516"