Difference between revisions of "RXN-10089"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10530 == * left end position: ** 187 * transcription direction: ** NEGATIVE * right end position: ** 3652 * centisome position: ** 2.211709...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] == * smiles: ** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O * inchi key: ** InCh...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] == |
| − | * | + | * smiles: |
| − | ** | + | ** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L |
| − | * | + | * common name: |
| − | ** | + | ** aldehydo-D-ribose 5-phosphate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 228.095 |
* Synonym(s): | * Synonym(s): | ||
| + | ** keto-D-ribose 5-phosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-15346]] | |
| − | + | * [[RXN-14997]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21115541 21115541] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58273 58273] |
| − | {{#set: | + | {{#set: smiles=[CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O}} |
| + | {{#set: inchi key=InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L}} | ||
| + | {{#set: common name=aldehydo-D-ribose 5-phosphate}} | ||
| + | {{#set: molecular weight=228.095 }} | ||
| + | {{#set: common name=keto-D-ribose 5-phosphate}} | ||
| + | {{#set: produced by=RXN-15346|RXN-14997}} | ||
Revision as of 17:23, 10 January 2018
Contents
Metabolite CPD-15895
- smiles:
- [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O
- inchi key:
- InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L
- common name:
- aldehydo-D-ribose 5-phosphate
- molecular weight:
- 228.095
- Synonym(s):
- keto-D-ribose 5-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.
