Difference between revisions of "R311-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] == * smiles: ** C(SCC(C([O-])=O)[N+])CC([N+])C([O-])=O * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11213 RXN-11213] == * direction: ** LEFT-TO-RIGHT * common name: ** methylmalonate-semialdehyde...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11213 RXN-11213] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** methylmalonate-semialdehyde_dehydrogenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.2.1.27 EC-1.2.1.27] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[WATER]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CH3-MALONATE-S-ALD]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PROPIONYL-COA]][c] '''+''' 1 [[HCO3]][c] | |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 H2O[c] '''+''' 1 NAD+[c] '''+''' 1 coenzyme A[c] '''+''' 1 (S)-methylmalonate-semialdehyde[c] '''=>''' 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 propanoyl-CoA[c] '''+''' 1 hydrogencarbonate[c] |
− | == | + | |
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * [[Tiso_gene_11323]] |
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***AUTOMATED-NAME-MATCH | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[VALDEG-PWY]], L-valine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=VALDEG-PWY VALDEG-PWY] | ||
+ | ** '''8''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[esiliculosus]] | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[experimental_annotation]] | ||
+ | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20804 20804] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00935 R00935] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=methylmalonate-semialdehyde_dehydrogenase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-1.2.1.27}} |
− | + | {{#set: gene associated=Tiso_gene_11323}} | |
− | + | {{#set: in pathway=VALDEG-PWY}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | {{#set: reconstruction source=esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:23, 10 January 2018
Contents
Reaction RXN-11213
- direction:
- LEFT-TO-RIGHT
- common name:
- methylmalonate-semialdehyde_dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 NAD[c] + 1 CO-A[c] + 1 CH3-MALONATE-S-ALD[c] => 1 NADH[c] + 1 PROTON[c] + 1 PROPIONYL-COA[c] + 1 HCO3[c]
- With common name(s):
- 1 H2O[c] + 1 NAD+[c] + 1 coenzyme A[c] + 1 (S)-methylmalonate-semialdehyde[c] => 1 NADH[c] + 1 H+[c] + 1 propanoyl-CoA[c] + 1 hydrogencarbonate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_11323
- IN-SILICO_ANNOTATION
- AUTOMATED-NAME-MATCH
- pantograph-esiliculosus
- IN-SILICO_ANNOTATION
Pathways
- VALDEG-PWY, L-valine degradation I: VALDEG-PWY
- 8 reactions found over 8 reactions in the full pathway
Reconstruction information
External links