Difference between revisions of "Tiso gene 19763"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RETINAL RETINAL] == * smiles: ** CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Tiso_gene_19905 == * left end position: ** 32 * transcription direction: ** POSITIVE * right end position: ** 1141 * centisome position: ** 1.6528925...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19905 == |
− | * | + | * left end position: |
− | ** | + | ** 32 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1141 |
− | * | + | * centisome position: |
− | ** | + | ** 1.6528925 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[CYTOCHROME-B5-REDUCTASE-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
− | + | ***ec-number | |
− | * [[ | + | ** [[pantograph]]-[[athaliana]] |
+ | * [[RXN-11195]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=32}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1141}} | |
− | + | {{#set: centisome position=1.6528925 }} | |
− | + | {{#set: reaction associated=CYTOCHROME-B5-REDUCTASE-RXN|RXN-11195}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 17:24, 10 January 2018
Gene Tiso_gene_19905
- left end position:
- 32
- transcription direction:
- POSITIVE
- right end position:
- 1141
- centisome position:
- 1.6528925
- Synonym(s):
Reactions associated
- CYTOCHROME-B5-REDUCTASE-RXN
- in-silico_annotation
- ec-number
- pantograph-athaliana
- in-silico_annotation
- RXN-11195
- in-silico_annotation
- ec-number
- in-silico_annotation