Difference between revisions of "SACCHAROPINE"

Revision as of 17:24, 10 January 2018

"C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_9459 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13008 CPD-13008] ==
-* left end position:
+* smiles:
-** 3268
+** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O
-* transcription direction:
+* inchi key:
-** POSITIVE
+** InChIKey=LROTZSUGDZPWDN-ZDUSSCGKSA-N
-* right end position:
+* common name:
-** 4695
+** 3',5'-diiodothyronine
-* centisome position:
+* molecular weight:
-** 35.019287
+** 525.081
 * Synonym(s):
+** 3',5'-diiodo-L-thyronine
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[3.1.26.4-RXN]]
+* [[RXN-12037]]
-** in-silico_annotation
+== Reaction(s) known to produce the compound ==
-***ec-number
+== Reaction(s) of unknown directionality ==
-** [[pantograph]]-[[esiliculosus]]
-== Pathways associated ==
 == External links  ==
-{{#set: left end position=3268}}
+* PUBCHEM:
-{{#set: transcription direction=POSITIVE}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986088 50986088]
-{{#set: right end position=4695}}
+{{#set: smiles=C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O}}
-{{#set: centisome position=35.019287    }}
+{{#set: inchi key=InChIKey=LROTZSUGDZPWDN-ZDUSSCGKSA-N}}
-{{#set: reaction associated=3.1.26.4-RXN}}
+{{#set: common name=3',5'-diiodothyronine}}
+{{#set: molecular weight=525.081    }}
+{{#set: common name=3',5'-diiodo-L-thyronine}}
+{{#set: consumed by=RXN-12037}}