Difference between revisions of "RXN-7968"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])...")
 
(Created page with "Category:Gene == Gene Tiso_gene_14329 == * left end position: ** 141 * transcription direction: ** POSITIVE * right end position: ** 3346 * centisome position: ** 2.464604...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] ==
+
== Gene Tiso_gene_14329 ==
−
* smiles:
+
* left end position:
−
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O
+
** 141
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** adenosine 5'-phosphoselenate
+
** 3346
−
* molecular weight:
+
* centisome position:
−
** 473.174    
+
** 2.464604    
 
* Synonym(s):
 
* Synonym(s):
−
** adenylyl-selenate
 
−
** APSe
 
−
** adenosine phosphoselenate
 
−
** adenylylselenate
 
−
** adenosine-5'-phosphoselenate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-12347]]
−
* [[RXN-12720]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6795]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=141}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657723 90657723]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3346}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2485 2485]
+
{{#set: centisome position=2.464604   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=RXN-12347}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05686 C05686]
+
{{#set: pathway associated=PWY-6795}}
−
* HMDB : HMDB04112
+
−
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O}}
+
−
{{#set: inchi key=InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M}}
+
−
{{#set: common name=adenosine 5'-phosphoselenate}}
+
−
{{#set: molecular weight=473.174   }}
+
−
{{#set: common name=adenylyl-selenate|APSe|adenosine phosphoselenate|adenylylselenate|adenosine-5'-phosphoselenate}}
+
−
{{#set: produced by=RXN-12720}}
+

Revision as of 17:24, 10 January 2018

Gene Tiso_gene_14329

  • left end position:
    • 141
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3346
  • centisome position:
    • 2.464604
  • Synonym(s):

Reactions associated

  • RXN-12347
    • in-silico_annotation
      • automated-name-match

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-7968&oldid=17666"