Difference between revisions of "CPD-10244"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UDPGALor UDPGALor] == * direction: ** LEFT-TO-RIGHT * common name: ** UDP-D-galactose:NAD+ 6-oxidor...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UDPGALor UDPGALor] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O
 +
* inchi key:
 +
** InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M
 
* common name:
 
* common name:
−
** UDP-D-galactose:NAD+ 6-oxidoreductase
+
** adenosine 5'-phosphoselenate
 +
* molecular weight:
 +
** 473.174   
 
* Synonym(s):
 
* Synonym(s):
 +
** adenylyl-selenate
 +
** APSe
 +
** adenosine phosphoselenate
 +
** adenylylselenate
 +
** adenosine-5'-phosphoselenate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[CPD-14553]][c] '''+''' 2.0 [[NAD]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 2.0 [[NADH]][c] '''+''' 3.0 [[PROTON]][c] '''+''' 1.0 [[UDP-D-GALACTURONATE]][c]
+
* [[RXN-12720]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 UDP-α-D-galactose[c] '''+''' 2.0 NAD+[c] '''+''' 1.0 H2O[c] '''=>''' 2.0 NADH[c] '''+''' 3.0 H+[c] '''+''' 1.0 UDP-α-D-galacturonate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_4219]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=UDP-D-galactose:NAD+ 6-oxidoreductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657723 90657723]
−
{{#set: gene associated=Tiso_gene_4219}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2485 2485]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05686 C05686]
−
{{#set: reconstruction source=creinhardtii}}
+
* HMDB : HMDB04112
 +
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O}}
 +
{{#set: inchi key=InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M}}
 +
{{#set: common name=adenosine 5'-phosphoselenate}}
 +
{{#set: molecular weight=473.174    }}
 +
{{#set: common name=adenylyl-selenate|APSe|adenosine phosphoselenate|adenylylselenate|adenosine-5'-phosphoselenate}}
 +
{{#set: produced by=RXN-12720}}

Revision as of 17:25, 10 January 2018

Metabolite CPD-13713

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O
  • inchi key:
    • InChIKey=XCADVMZZFPIERR-KQYNXXCUSA-M
  • common name:
    • adenosine 5'-phosphoselenate
  • molecular weight:
    • 473.174
  • Synonym(s):
    • adenylyl-selenate
    • APSe
    • adenosine phosphoselenate
    • adenylylselenate
    • adenosine-5'-phosphoselenate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(=O)([O-])O[Se](=O)(=O)O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-10244&oldid=17718"