Difference between revisions of "RXN-15068"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYR TYR] == * smiles: ** C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-] * inchi key: ** InChIKey=OUYCCCASQ...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7064 CPD-7064] == * smiles: ** CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7064 CPD-7064] == |
* smiles: | * smiles: | ||
| − | ** C(C( | + | ** CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=VHQSFNUIHPNTMW-LRYVNUGJSA-M |
* common name: | * common name: | ||
| − | ** | + | ** primary fluorescent chlorophyll catabolite |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 626.708 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** pFCC |
| − | ** | + | ** (82R,12S,13S)-12-(2-carboxyethyl)-3-ethyl-1-formyl-82-(methoxycarbonyl)-2,7,13,17-tetramethyl-18-vinyl-12,13-dihydro-8,10-ethanobilene-b-81,19(16H)-dione |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7741]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819909 91819909] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58719 58719] |
| − | + | {{#set: smiles=CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O)}} | |
| − | {{#set: smiles=C(C( | + | {{#set: inchi key=InChIKey=VHQSFNUIHPNTMW-LRYVNUGJSA-M}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=primary fluorescent chlorophyll catabolite}} |
| − | {{#set: common name= | + | {{#set: molecular weight=626.708 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=pFCC|(82R,12S,13S)-12-(2-carboxyethyl)-3-ethyl-1-formyl-82-(methoxycarbonyl)-2,7,13,17-tetramethyl-18-vinyl-12,13-dihydro-8,10-ethanobilene-b-81,19(16H)-dione}} |
| − | {{#set: common name= | + | {{#set: produced by=RXN-7741}} |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Revision as of 17:25, 10 January 2018
Contents
Metabolite CPD-7064
- smiles:
- CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O)
- inchi key:
- InChIKey=VHQSFNUIHPNTMW-LRYVNUGJSA-M
- common name:
- primary fluorescent chlorophyll catabolite
- molecular weight:
- 626.708
- Synonym(s):
- pFCC
- (82R,12S,13S)-12-(2-carboxyethyl)-3-ethyl-1-formyl-82-(methoxycarbonyl)-2,7,13,17-tetramethyl-18-vinyl-12,13-dihydro-8,10-ethanobilene-b-81,19(16H)-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O)" cannot be used as a page name in this wiki.
