Difference between revisions of "RXN-2541"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=Forthi Forthi] == * direction: ** LEFT-TO-RIGHT * common name: ** formate transport out via proton...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-339 RXN1G-339] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis-cis-delta7...") |
||
Line 1: | Line 1: | ||
[[Category:Reaction]] | [[Category:Reaction]] | ||
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object= | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-339 RXN1G-339] == |
* direction: | * direction: | ||
** LEFT-TO-RIGHT | ** LEFT-TO-RIGHT | ||
* common name: | * common name: | ||
− | ** | + | ** trans-delta2-cis-cis-delta7-19-C38:3-[acyl-carrier protein] reductase |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4] | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction Formula == | == Reaction Formula == | ||
* With identifiers: | * With identifiers: | ||
− | ** 1 | + | ** 1 [[trans-D2-cis-cis-D7-19-C38-3-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[cis-cis-D7-19-C38-2-ACPs]][c] |
* With common name(s): | * With common name(s): | ||
− | ** 1 | + | ** 1 a trans-delta2-cis-cis-delta7-19-C38:3-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 a cis,cis-delta7,19-C38:2-[acp][c] |
== Genes associated with this reaction == | == Genes associated with this reaction == | ||
Genes have been associated with this reaction based on different elements listed below. | Genes have been associated with this reaction based on different elements listed below. | ||
− | * [[ | + | * [[Tiso_gene_10778]] |
− | ** [[pantograph]]-[[ | + | ** [[pantograph]]-[[esiliculosus]] |
== Pathways == | == Pathways == | ||
+ | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | ||
+ | ** '''86''' reactions found over '''182''' reactions in the full pathway | ||
== Reconstruction information == | == Reconstruction information == | ||
* [[orthology]]: | * [[orthology]]: | ||
** [[pantograph]]: | ** [[pantograph]]: | ||
− | *** [[ | + | *** [[esiliculosus]] |
== External links == | == External links == | ||
{{#set: direction=LEFT-TO-RIGHT}} | {{#set: direction=LEFT-TO-RIGHT}} | ||
− | {{#set: common name= | + | {{#set: common name=trans-delta2-cis-cis-delta7-19-C38:3-[acyl-carrier protein] reductase}} |
− | {{#set: gene associated= | + | {{#set: ec number=EC-1.3.1.M4}} |
− | {{#set: in pathway=}} | + | {{#set: gene associated=Tiso_gene_10778}} |
+ | {{#set: in pathway=PWYG-321}} | ||
{{#set: reconstruction category=orthology}} | {{#set: reconstruction category=orthology}} | ||
{{#set: reconstruction tool=pantograph}} | {{#set: reconstruction tool=pantograph}} | ||
− | {{#set: reconstruction source= | + | {{#set: reconstruction source=esiliculosus}} |
Revision as of 17:25, 10 January 2018
Contents
Reaction RXN1G-339
- direction:
- LEFT-TO-RIGHT
- common name:
- trans-delta2-cis-cis-delta7-19-C38:3-[acyl-carrier protein] reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 trans-D2-cis-cis-D7-19-C38-3-ACPs[c] + 1 PROTON[c] + 1 NADH[c] => 1 NAD[c] + 1 cis-cis-D7-19-C38-2-ACPs[c]
- With common name(s):
- 1 a trans-delta2-cis-cis-delta7-19-C38:3-[acp][c] + 1 H+[c] + 1 NADH[c] => 1 NAD+[c] + 1 a cis,cis-delta7,19-C38:2-[acp][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
External links
"trans-delta2-cis-cis-delta7-19-C38:3-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.