Difference between revisions of "Tiso gene 9580"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17329 CPD-17329] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8450 RXN-8450] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17329 CPD-17329] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8450 RXN-8450] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=WSALICWLARPULC-GJYKHRJNSA-J
+
** [http://enzyme.expasy.org/EC/1.14.11.23 EC-1.14.11.23]
−
* common name:
+
−
** 3-oxo-tetracosatetraenoyl-CoA
+
−
* molecular weight:
+
−
** 1120.05   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA
 
−
** 3-oxo-(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17109]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[CPD-7087]][c] '''=>''' 1 [[SUC]][c] '''+''' 1 [[MYRICETIN]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 oxygen[c] '''+''' 1 2-oxoglutarate[c] '''+''' 1 (+)-dihydromyricetin[c] '''=>''' 1 succinate[c] '''+''' 1 myricetin[c] '''+''' 1 H2O[c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_3330]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-3101]], flavonol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3101 PWY-3101]
 +
** '''4''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-5391]], syringetin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5391 PWY-5391]
 +
** '''1''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 +
*** [[athaliana]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581124 71581124]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06539 R06539]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73857 73857]
+
{{#set: ec number=EC-1.14.11.23}}
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: gene associated=Tiso_gene_3330}}
−
{{#set: inchi key=InChIKey=WSALICWLARPULC-GJYKHRJNSA-J}}
+
{{#set: in pathway=PWY-3101|PWY-5391}}
−
{{#set: common name=3-oxo-tetracosatetraenoyl-CoA}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=1120.05    }}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=3-oxo-(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA|3-oxo-(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA}}
+
{{#set: reconstruction source=esiliculosus|athaliana}}
−
{{#set: consumed by=RXN-17109}}
+

Revision as of 17:25, 10 January 2018

Reaction RXN-8450

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-3101, flavonol biosynthesis: PWY-3101
    • 4 reactions found over 7 reactions in the full pathway
  • PWY-5391, syringetin biosynthesis: PWY-5391
    • 1 reactions found over 5 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9580&oldid=17755"