Difference between revisions of "Tiso gene 596"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14736 CPD-14736] == * smiles: ** C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1) * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Tiso_gene_8007 == * left end position: ** 4591 * transcription direction: ** POSITIVE * right end position: ** 6208 * centisome position: ** 43.19315...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8007 == |
− | * | + | * left end position: |
− | ** | + | ** 4591 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 6208 |
− | * | + | * centisome position: |
− | ** | + | ** 43.19315 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]] |
− | * | + | ** in-silico_annotation |
− | + | ***automated-name-match | |
− | * | + | == Pathways associated == |
− | == | + | * [[TRIGLSYN-PWY]] |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=4591}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=6208}} | |
− | + | {{#set: centisome position=43.19315 }} | |
− | + | {{#set: reaction associated=DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN}} | |
− | + | {{#set: pathway associated=TRIGLSYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Revision as of 18:26, 10 January 2018
Gene Tiso_gene_8007
- left end position:
- 4591
- transcription direction:
- POSITIVE
- right end position:
- 6208
- centisome position:
- 43.19315
- Synonym(s):
Reactions associated
- DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation