Difference between revisions of "Tiso gene 451"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9460 CPD-9460] == * smiles: ** CC6(CCC5(CCC1(C(=CC[CH]2(C1(CC[CH]3(C2(CCC(C3(C)C)OC4(C(C(C(...")
 
(Created page with "Category:Gene == Gene Tiso_gene_7107 == * left end position: ** 9641 * transcription direction: ** POSITIVE * right end position: ** 11470 * centisome position: ** 83.8347...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9460 CPD-9460] ==
+
== Gene Tiso_gene_7107 ==
−
* smiles:
+
* left end position:
−
** CC6(CCC5(CCC1(C(=CC[CH]2(C1(CC[CH]3(C2(CCC(C3(C)C)OC4(C(C(C(C(O4)C(=O)[O-])O)O)O))C))C))[CH]5C6)C)C(=O)[O-])C
+
** 9641
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IUCHKMAZAWJNBJ-RCYXVVTDSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** oleanolate 3 β-D-glucuronoside
+
** 11470
−
* molecular weight:
+
* centisome position:
−
** 630.817    
+
** 83.834785    
 
* Synonym(s):
 
* Synonym(s):
−
** oleanolic acid 3 β-D-glucuronoside
 
−
** oleanoic acid 3-O-glucuronide
 
−
** monoglucuronide F
 
−
** oleanolic acid 3-O-glucuronide
 
−
** oleanolic acid 3-O-monoglucuronide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN]]
−
* [[RXN-9000]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 +
* [[VALDEG-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=9641}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659092 90659092]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=11470}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37658 37658]
+
{{#set: centisome position=83.834785   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08964 C08964]
+
{{#set: pathway associated=VALDEG-PWY}}
−
* HMDB : HMDB40851
+
−
{{#set: smiles=CC6(CCC5(CCC1(C(=CC[CH]2(C1(CC[CH]3(C2(CCC(C3(C)C)OC4(C(C(C(C(O4)C(=O)[O-])O)O)O))C))C))[CH]5C6)C)C(=O)[O-])C}}
+
−
{{#set: inchi key=InChIKey=IUCHKMAZAWJNBJ-RCYXVVTDSA-L}}
+
−
{{#set: common name=oleanolate 3 β-D-glucuronoside}}
+
−
{{#set: molecular weight=630.817   }}
+
−
{{#set: common name=oleanolic acid 3 β-D-glucuronoside|oleanoic acid 3-O-glucuronide|monoglucuronide F|oleanolic acid 3-O-glucuronide|oleanolic acid 3-O-monoglucuronide}}
+
−
{{#set: produced by=RXN-9000}}
+

Revision as of 17:27, 10 January 2018

Gene Tiso_gene_7107

  • left end position:
    • 9641
  • transcription direction:
    • POSITIVE
  • right end position:
    • 11470
  • centisome position:
    • 83.834785
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_451&oldid=17870"